279226-70-9 Purity
95%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H10ClN3O2.
The molecular weight of the compound is 239.66 g/mol.
The IUPAC name of the compound is ethyl 6-chloro-2-methylimidazo[1,2-b]pyridazine-3-carboxylate.
The InChIKey of the compound is OJHHQMWNFHWAFR-UHFFFAOYSA-N.
The Canonical SMILES representation of the compound is CCOC(=O)C1=C(N=C2N1N=C(C=C2)Cl)C.
The XLogP3-AA value of the compound is 2.2.
The compound has 0 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.
The compound has 3 rotatable bond counts.
Yes, the compound is canonicalized.