6-Chloro-1H-indazole-4-boronic acid pinacol ester

• CAS: 1802433-98-2
• Catalog Number: ACM1802433982
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of 6-Chloro-1H-indazole-4-boronic acid pinacol ester?

The molecular formula is C13H16BClN2O2.

When was 6-Chloro-1H-indazole-4-boronic acid pinacol ester created and modified?

It was created on 2015-12-03 and modified on 2023-12-02.

What is the IUPAC name of 6-Chloro-1H-indazole-4-boronic acid pinacol ester?

The IUPAC name is 6-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole.

What is the InChI of 6-Chloro-1H-indazole-4-boronic acid pinacol ester?

The InChI is InChI=1S/C13H16BClN2O2/c1-12(2)13(3,4)19-14(18-12)10-5-8(15)6-11-9(10)7-16-17-11/h5-7H,1-4H3,(H,16,17).

What is the Canonical SMILES of 6-Chloro-1H-indazole-4-boronic acid pinacol ester?

The Canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC3=C2C=NN3)Cl.

What is the molecular weight of 6-Chloro-1H-indazole-4-boronic acid pinacol ester?

The molecular weight is 278.54 g/mol.

How many hydrogen bond donor counts does 6-Chloro-1H-indazole-4-boronic acid pinacol ester have?

It has 1 hydrogen bond donor count.

What is the topological polar surface area of 6-Chloro-1H-indazole-4-boronic acid pinacol ester?

It is 47.1Ų.

How many heavy atoms are present in 6-Chloro-1H-indazole-4-boronic acid pinacol ester?

There are 19 heavy atoms.

Is the compound canonicalized in PubChem?

Yes, the compound is canonicalized in PubChem.