6-Bromo-N-methylquinolin-4-amine

• CAS: 916812-31-2
• Catalog Number: ACM916812312
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 6-Bromo-N-methylquinolin-4-amine?

The molecular formula is C10H9BrN2.

What is the molecular weight of 6-Bromo-N-methylquinolin-4-amine?

The molecular weight is 237.10 g/mol.

What is the IUPAC name of 6-Bromo-N-methylquinolin-4-amine?

The IUPAC name is 6-bromo-N-methylquinolin-4-amine.

What is the InChI of 6-Bromo-N-methylquinolin-4-amine?

The InChI is InChI=1S/C10H9BrN2/c1-12-9-4-5-13-10-3-2-7(11)6-8(9)10/h2-6H,1H3,(H,12,13).

What is the InChIKey of 6-Bromo-N-methylquinolin-4-amine?

The InChIKey is FHWDWCUTMVHJCX-UHFFFAOYSA-N.

What is the canonical SMILES of 6-Bromo-N-methylquinolin-4-amine?

The canonical SMILES is CNC1=C2C=C(C=CC2=NC=C1)Br.

What is the CAS number of 6-Bromo-N-methylquinolin-4-amine?

The CAS number is 916812-31-2.

What is the XLogP3-AA value of 6-Bromo-N-methylquinolin-4-amine?

The XLogP3-AA value is 2.9.

How many hydrogen bond donor count does 6-Bromo-N-methylquinolin-4-amine have?

It has 1 hydrogen bond donor count.

How many rotatable bond count does 6-Bromo-N-methylquinolin-4-amine have?

It has 1 rotatable bond count.