6-Bromo-3-nitroquinolin-4-ol

• CAS: 853908-50-6
• Catalog Number: ACM853908506
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 6-Bromo-3-nitroquinolin-4-ol?

The molecular formula of 6-Bromo-3-nitroquinolin-4-ol is C9H5BrN2O3.

When was 6-Bromo-3-nitroquinolin-4-ol created?

6-Bromo-3-nitroquinolin-4-ol was created on May 28, 2009.

What is the IUPAC name of 6-Bromo-3-nitroquinolin-4-ol?

The IUPAC name of 6-Bromo-3-nitroquinolin-4-ol is 6-bromo-3-nitro-1H-quinolin-4-one.

What is the InChI of 6-Bromo-3-nitroquinolin-4-ol?

The InChI of 6-Bromo-3-nitroquinolin-4-ol is InChI=1S/C9H5BrN2O3/c10-5-1-2-7-6(3-5)9(13)8(4-11-7)12(14)15/h1-4H,(H,11,13).

What is the molecular weight of 6-Bromo-3-nitroquinolin-4-ol?

The molecular weight of 6-Bromo-3-nitroquinolin-4-ol is 269.05 g/mol.

What is the CAS number of 6-Bromo-3-nitroquinolin-4-ol?

The CAS number of 6-Bromo-3-nitroquinolin-4-ol is 853908-50-6.

What is the XLogP3-AA value of 6-Bromo-3-nitroquinolin-4-ol?

The XLogP3-AA value of 6-Bromo-3-nitroquinolin-4-ol is 2.3.

How many hydrogen bond donor counts does 6-Bromo-3-nitroquinolin-4-ol have?

6-Bromo-3-nitroquinolin-4-ol has 1 hydrogen bond donor count.

How many rotatable bond counts does 6-Bromo-3-nitroquinolin-4-ol have?

6-Bromo-3-nitroquinolin-4-ol does not have any rotatable bond count.

Is 6-Bromo-3-nitroquinolin-4-ol a canonicalized compound?

Yes, 6-Bromo-3-nitroquinolin-4-ol is a canonicalized compound.