6-Bromo-3-methyl-2-4-tolylquinoline-4-carboxylic acid

• CAS: 351000-02-7
• Catalog Number: ACM351000027
• Category: Bromine Series
• Molecular Weight: 356.21
• Molecular Formula: C₁₈H₁₄BrNO₂
• Synonyms: 6-Bromo-3-methyl-2-(4-methylphenyl)-4-quinolinecarboxylic acid;6-Bromo-3-methyl-2-p-tolyl-quinoline-4-carboxylic acid

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C18H14BrNO2.

What are the synonyms of the compound?

The synonyms of the compound are 351000-02-7, 6-bromo-3-methyl-2-4-tolylquinoline-4-carboxylic acid, 6-BROMO-3-METHYL-2-(P-TOLYL)QUINOLINE-4-CARBOXYLIC ACID, and 6-bromo-3-methyl-2-(4-methylphenyl)quinoline-4-carboxylic acid.

What is the molecular weight of the compound?

The molecular weight of the compound is 356.2 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 6-bromo-3-methyl-2-(4-methylphenyl)quinoline-4-carboxylic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C18H14BrNO2/c1-10-3-5-12(6-4-10)17-11(2)16(18(21)22)14-9-13(19)7-8-15(14)20-17/h3-9H,1-2H3,(H,21,22).

What is the InChIKey of the compound?

The InChIKey of the compound is IJKOKQJXLDYBKI-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is CC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)Br)C(=C2C)C(=O)O.

What is the CAS number of the compound?

The CAS number of the compound is 351000-02-7.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 4.8.

Is the compound canonicalized?

Yes, the compound is canonicalized.