CAS
52723-82-7 Purity
---
52723-82-7 Purity
---
Inquiry Basket
6-Bromo-3-Chromanone
CAS
944899-48-3
Catalog Number
ACM944899483
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 6-Bromo-3-Chromanone?
The molecular formula of 6-Bromo-3-Chromanone is C9H7BrO2.
What is the molecular weight of 6-Bromo-3-Chromanone?
The molecular weight of 6-Bromo-3-Chromanone is 227.05 g/mol.
What is the IUPAC name of 6-Bromo-3-Chromanone?
The IUPAC name of 6-Bromo-3-Chromanone is 6-bromo-4H-chromen-3-one.
What is the InChI of 6-Bromo-3-Chromanone?
The InChI of 6-Bromo-3-Chromanone is InChI=1S/C9H7BrO2/c10-7-1-2-9-6(3-7)4-8(11)5-12-9/h1-3H,4-5H2.
What is the InChIKey of 6-Bromo-3-Chromanone?
The InChIKey of 6-Bromo-3-Chromanone is VBRRRWJGQGGHLP-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromo-3-Chromanone?
The canonical SMILES of 6-Bromo-3-Chromanone is C1C(=O)COC2=C1C=C(C=C2)Br.
What is the CAS number of 6-Bromo-3-Chromanone?
The CAS number of 6-Bromo-3-Chromanone is 944899-48-3.
What is the XLogP3-AA value of 6-Bromo-3-Chromanone?
The XLogP3-AA value of 6-Bromo-3-Chromanone is 2.1.
How many hydrogen bond donor counts does 6-Bromo-3-Chromanone have?
6-Bromo-3-Chromanone has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 6-Bromo-3-Chromanone have?
6-Bromo-3-Chromanone has 2 hydrogen bond acceptor counts.
Recommended Products
