6-Bromo-2-naphthoic acid

• CAS: 5773-80-8
• Catalog Number: ACM5773808
• Category: Bromine Series
• Molecular Weight: 251.08
• Molecular Formula: C₁₁H₇BrO₂

Custom Q&A

What is the PubChem CID for 6-Bromo-2-naphthoic acid?

The PubChem CID for 6-Bromo-2-naphthoic acid is 4549852.

What is the molecular formula of 6-Bromo-2-naphthoic acid?

The molecular formula of 6-Bromo-2-naphthoic acid is C11H7BrO2.

What is the molecular weight of 6-Bromo-2-naphthoic acid?

The molecular weight of 6-Bromo-2-naphthoic acid is 251.08 g/mol.

What is the IUPAC name of 6-Bromo-2-naphthoic acid?

The IUPAC name of 6-Bromo-2-naphthoic acid is 6-bromonaphthalene-2-carboxylic acid.

What is the InChI key of 6-Bromo-2-naphthoic acid?

The InChI key of 6-Bromo-2-naphthoic acid is NPMCAVBMOTZUPD-UHFFFAOYSA-N.

What is the canonical SMILES of 6-Bromo-2-naphthoic acid?

The canonical SMILES of 6-Bromo-2-naphthoic acid is C1=CC2=C(C=CC(=C2)Br)C=C1C(=O)O.

What is the CAS number of 6-Bromo-2-naphthoic acid?

The CAS number of 6-Bromo-2-naphthoic acid is 5773-80-8.

What is the XLogP3 value of 6-Bromo-2-naphthoic acid?

The XLogP3 value of 6-Bromo-2-naphthoic acid is 4.

How many hydrogen bond donor counts does 6-Bromo-2-naphthoic acid have?

6-Bromo-2-naphthoic acid has 1 hydrogen bond donor count.

What is the topological polar surface area of 6-Bromo-2-naphthoic acid?

The topological polar surface area of 6-Bromo-2-naphthoic acid is 37.3Ų.