6-Bromo-[1,2,4]triazolo[1,5-a]pyridine

• CAS: 356560-80-0
• Catalog Number: ACM356560800
• Category: Alkenyl
• Molecular Weight: 198.02
• Molecular Formula: C₆H₃BrN₂S
• Hazard Statements: H302-H317
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the chemical formula of the compound?

The chemical formula of the compound is C6H4BrN3.

What is the molecular weight of the compound?

The molecular weight of the compound is 198.02 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 6-bromo-[1,2,4]triazolo[1,5-a]pyridine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C6H4BrN3/c7-5-1-2-6-8-4-9-10(6)3-5/h1-4H.

What is the InChIKey of the compound?

The InChIKey of the compound is CXRXKDSDRWLKTK-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1=CC2=NC=NN2C=C1Br.

What is the CAS number of the compound?

The CAS number of the compound is 356560-80-0.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.4.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.