6-Aminoimidazo[1,2-a]pyridine-2-carboxylic acid ethyl ester

• Catalog Number: ACMA00002052
• Category: Ethers
• Molecular Weight: 205.21
• Molecular Formula: C₁₀H₁₀O₅
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C10H11N3O2.

What are the synonyms of the compound?

The synonyms of the compound are ethyl 6-aminoimidazo[1,2-a]pyridine-2-carboxylate, 158980-21-3, and Imidazo[1,2-a]pyridine-2-carboxylic acid, 6-amino-, ethyl ester.

What is the molecular weight of the compound?

The molecular weight of the compound is 205.21 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is ethyl 6-aminoimidazo[1,2-a]pyridine-2-carboxylate.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C10H11N3O2/c1-2-15-10(14)8-6-13-5-7(11)3-4-9(13)12-8/h3-6H,2,11H2,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is PKWHXLCNUIXDIK-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CCOC(=O)C1=CN2C=C(C=CC2=N1)N.

What is the CAS number of the compound?

The CAS number of the compound is 158980-21-3.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.6.

Is the compound canonicalized?

Yes, the compound is canonicalized.