6-(4-Methylphenyl)-2-oxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid

• Catalog Number: ACMA00001035
• Category: Amines
• Molecular Weight: 232.24
• Molecular Formula: C₁₂H₁₂N₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C12H12N2O3.

What are the synonyms of the compound?

The synonyms of the compound are 6-(4-methylphenyl)-2-oxo-1,2,3,6-tetrahydro-4-pyrimidinecarboxylic acid, 446275-91-8, 4-(4-methylphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-6-carboxylic acid, 6-(4-methylphenyl)-2-oxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid, DTXSID801151377.

What is the molecular weight of the compound?

The molecular weight of the compound is 232.23 g/mol.

What is the IUPAC Name of the compound?

The IUPAC Name of the compound is 4-(4-methylphenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-6-carboxylic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C12H12N2O3/c1-7-2-4-8(5-3-7)9-6-10(11(15)16)14-12(17)13-9/h2-6,9H,1H3,(H,15,16)(H2,13,14,17).

What is the InChIKey of the compound?

The InChIKey of the compound is KQYYDIRBSOVKSK-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is CC1=CC=C(C=C1)C2C=C(NC(=O)N2)C(=O)O.

What is the CAS number of the compound?

The CAS number of the compound is 446275-91-8.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.2.

Is the compound canonicalized?

Yes, the compound is canonicalized.