1003298-84-7 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula is C15H23BN2O3.
The molecular weight is 290.17 g/mol.
The IUPAC name is 1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]pyrrolidin-3-ol.
The Canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)N3CCC(C3)O.
The compound has 1 hydrogen bond donor count.
The compound has 5 hydrogen bond acceptor counts.
The exact mass is 290.1801728 g/mol.
The topological polar surface area is 54.8 Ų.
The compound has 21 heavy atoms.
Yes, the compound is canonicalized.