5-Oxo-2,3-dihydro-1H,5H-pyrido[3,2,1-ij]quinoline-6-carbaldehyde

• Catalog Number: ACMA00001102
• Category: Amines
• Molecular Weight: 213.23
• Molecular Formula: C₁₃H₁₀Cl₂N₂O
• Hazard Statements: H301
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C13H11NO2.

What is the molecular weight of the compound?

The molecular weight of the compound is 213.23 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-oxo-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraene-3-carbaldehyde.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C13H11NO2/c15-8-11-7-10-4-1-3-9-5-2-6-14(12(9)10)13(11)16/h1,3-4,7-8H,2,5-6H2.

What is the InChIKey of the compound?

The InChIKey of the compound is FPZDNTSHNYEKBC-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1CC2=CC=CC3=C2N(C1)C(=O)C(=C3)C=O.

What is the CAS number of the compound?

The CAS number of the compound is 386715-48-6.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.6.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.