5-Hydroxyhexanoic acid

• CAS: 185956-02-9
• Catalog Number: ACM185956029
• Category: Other Products
• Molecular Weight: 132.16
• Molecular Formula: C₆H₁₂O₃
• Synonyms: 5-HYDROXYHEXANOIC ACID;5-Hydroxycaproic acid;5-Hydroxyhexanoic Acid SodiuM Salt

Custom Q&A

What is the molecular formula of 5-Hydroxyhexanoic acid?

The molecular formula of 5-Hydroxyhexanoic acid is C6H12O3.

What is the molecular weight of 5-Hydroxyhexanoic acid?

The molecular weight of 5-Hydroxyhexanoic acid is 132.16 g/mol.

What is the IUPAC name of 5-Hydroxyhexanoic acid?

The IUPAC name of 5-Hydroxyhexanoic acid is 5-hydroxyhexanoic acid.

What is the InChI of 5-Hydroxyhexanoic acid?

The InChI of 5-Hydroxyhexanoic acid is InChI=1S/C6H12O3/c1-5(7)3-2-4-6(8)9/h5,7H,2-4H2,1H3,(H,8,9).

How many hydrogen bond donor counts does 5-Hydroxyhexanoic acid have?

5-Hydroxyhexanoic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 5-Hydroxyhexanoic acid have?

5-Hydroxyhexanoic acid has 3 hydrogen bond acceptor counts.

What is the exact mass of 5-Hydroxyhexanoic acid?

The exact mass of 5-Hydroxyhexanoic acid is 132.078644241 g/mol.

How many rotatable bond counts does 5-Hydroxyhexanoic acid have?

5-Hydroxyhexanoic acid has 4 rotatable bond counts.

What is the topological polar surface area of 5-Hydroxyhexanoic acid?

The topological polar surface area of 5-Hydroxyhexanoic acid is 57.5 Ų.

Is 5-Hydroxyhexanoic acid considered as a canonical compound?

Yes, 5-Hydroxyhexanoic acid is considered as a canonical compound.