5-Chloro-2-fluoropyridin-3-ol

• CAS: 1003711-65-6
• Catalog Number: ACM1003711656-1
• Category: Pyridines
• Molecular Weight: 147.5
• Molecular Formula: C5H3ClFNO
• Synonyms: 5-Chloro-2-fluoro-3-hydroxypyridine

Custom Q&A

What is the molecular formula of 5-Chloro-2-fluoropyridin-3-ol?

The molecular formula of 5-Chloro-2-fluoropyridin-3-ol is C5H3ClFNO.

What is the molecular weight of 5-Chloro-2-fluoropyridin-3-ol?

The molecular weight of 5-Chloro-2-fluoropyridin-3-ol is 147.53 g/mol.

When was 5-Chloro-2-fluoropyridin-3-ol first created?

5-Chloro-2-fluoropyridin-3-ol was first created on 2009-05-28.

What is the IUPAC name of 5-Chloro-2-fluoropyridin-3-ol?

The IUPAC name of 5-Chloro-2-fluoropyridin-3-ol is 5-chloro-2-fluoropyridin-3-ol.

What is the InChI of 5-Chloro-2-fluoropyridin-3-ol?

The InChI of 5-Chloro-2-fluoropyridin-3-ol is InChI=1S/C5H3ClFNO/c6-3-1-4(9)5(7)8-2-3/h1-2,9H.

How many hydrogen bond donor counts does 5-Chloro-2-fluoropyridin-3-ol have?

5-Chloro-2-fluoropyridin-3-ol has 1 hydrogen bond donor count.

What is the topological polar surface area of 5-Chloro-2-fluoropyridin-3-ol?

The topological polar surface area of 5-Chloro-2-fluoropyridin-3-ol is 33.1 Ų.

How many rotatable bond counts does 5-Chloro-2-fluoropyridin-3-ol have?

5-Chloro-2-fluoropyridin-3-ol has 0 rotatable bond counts.

Is 5-Chloro-2-fluoropyridin-3-ol a canonicalized compound?

Yes, 5-Chloro-2-fluoropyridin-3-ol is a canonicalized compound.

What is the formal charge of 5-Chloro-2-fluoropyridin-3-ol?

The formal charge of 5-Chloro-2-fluoropyridin-3-ol is 0.