5-Carbamoyl-2-fluorophenyboronic acid

• CAS: 874289-39-1
• Catalog Number: ACM874289391
• Category: Boronic Acids
• Molecular Weight: 182.94
• Molecular Formula: C₇H₇BFNO₃

Custom Q&A

What is the molecular formula of 5-Carbamoyl-2-fluorophenyboronic acid?

The molecular formula is C7H7BFNO3.

What is the molecular weight of 5-Carbamoyl-2-fluorophenyboronic acid?

The molecular weight is 182.95 g/mol.

What is the IUPAC name of 5-Carbamoyl-2-fluorophenyboronic acid?

The IUPAC name is (5-carbamoyl-2-fluorophenyl)boronic acid.

What is the InChI of 5-Carbamoyl-2-fluorophenyboronic acid?

The InChI is InChI=1S/C7H7BFNO3/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,12-13H,(H2,10,11).

What is the InChIKey of 5-Carbamoyl-2-fluorophenyboronic acid?

The InChIKey is NDVPMVJEURRBQM-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Carbamoyl-2-fluorophenyboronic acid?

The canonical SMILES is B(C1=C(C=CC(=C1)C(=O)N)F)(O)O.

What is the CAS number of 5-Carbamoyl-2-fluorophenyboronic acid?

The CAS number is 874289-39-1.

What is the European Community (EC) number of 5-Carbamoyl-2-fluorophenyboronic acid?

The European Community (EC) number is 810-586-7.

What is the hydrogen bond donor count of 5-Carbamoyl-2-fluorophenyboronic acid?

The hydrogen bond donor count is 3.

Is 5-Carbamoyl-2-fluorophenyboronic acid a canonicalized compound?

Yes, 5-Carbamoyl-2-fluorophenyboronic acid is a canonicalized compound.