5-Bromo-3-methoxypyridin-2(1H)-one

• CAS: 1189757-62-7
• Catalog Number: ACM1189757627
• Category: Pyridines
• Molecular Weight: 204.0
• Molecular Formula: C6H6BrNO2
• Synonyms: 5-Bromo-3-methoxypyridin-2-ol

Custom Q&A

What is the molecular formula of 5-Bromo-3-methoxypyridin-2(1H)-one?

The molecular formula of 5-Bromo-3-methoxypyridin-2(1H)-one is C6H6BrNO2.

What is the molecular weight of 5-Bromo-3-methoxypyridin-2(1H)-one?

The molecular weight of 5-Bromo-3-methoxypyridin-2(1H)-one is 204.02 g/mol.

What is the IUPAC Name of 5-Bromo-3-methoxypyridin-2(1H)-one?

The IUPAC Name of 5-Bromo-3-methoxypyridin-2(1H)-one is 5-bromo-3-methoxy-1H-pyridin-2-one.

What is the InChI of 5-Bromo-3-methoxypyridin-2(1H)-one?

The InChI of 5-Bromo-3-methoxypyridin-2(1H)-one is InChI=1S/C6H6BrNO2/c1-10-5-2-4(7)3-8-6(5)9/h2-3H,1H3,(H,8,9).

What is the InChIKey of 5-Bromo-3-methoxypyridin-2(1H)-one?

The InChIKey of 5-Bromo-3-methoxypyridin-2(1H)-one is PTFYUJWNSXKSFV-UHFFFAOYSA-N.

What is the Canonical SMILES of 5-Bromo-3-methoxypyridin-2(1H)-one?

The Canonical SMILES of 5-Bromo-3-methoxypyridin-2(1H)-one is COC1=CC(=CNC1=O)Br.

What is the CAS number of 5-Bromo-3-methoxypyridin-2(1H)-one?

The CAS number of 5-Bromo-3-methoxypyridin-2(1H)-one is 1189757-62-7.

How many hydrogen bond donor counts does 5-Bromo-3-methoxypyridin-2(1H)-one have?

5-Bromo-3-methoxypyridin-2(1H)-one has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 5-Bromo-3-methoxypyridin-2(1H)-one have?

5-Bromo-3-methoxypyridin-2(1H)-one has 2 hydrogen bond acceptor counts.