5-Bromo-3-isobutyl-1-phenyl-1H-pyrazole

• CAS: 1188116-52-0
• Catalog Number: ACM1188116520
• Category: Bromine Series

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C13H15BrN2.

What are some synonyms of the compound?

Some synonyms of the compound are 5-bromo-3-isobutyl-1-phenyl-1H-pyrazole, 1188116-52-0, and 5-bromo-3-(2-methylpropyl)-1-phenylpyrazole.

What is the molecular weight of the compound?

The molecular weight of the compound is 279.18 g/mol.

When was the compound created and modified?

The compound was created on May 11, 2012, and last modified on December 2, 2023.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 5-bromo-3-(2-methylpropyl)-1-phenylpyrazole.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C13H15BrN2/c1-10(2)8-11-9-13(14)16(15-11)12-6-4-3-5-7-12/h3-7,9-10H,8H2,1-2H3.

What is the InChIKey of the compound?

The InChIKey of the compound is LLUUVYHVMBMKFI-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC(C)CC1=NN(C(=C1)Br)C2=CC=CC=C2.

What is the CAS number of the compound?

The CAS number of the compound is 1188116-52-0.

Is the compound canonicalized?

Yes, the compound is canonicalized.