5-Bromo-2-(pyrrolidin-3-yloxy)pyrimidine

• CAS: 914347-82-3
• Catalog Number: ACM914347823
• Category: Bromine Series
• Molecular Weight: 244.09
• Molecular Formula: C₈H₁₀BrN₃O
• Synonyms: 5-BROMO-2-(PYRROLIDIN-3-YLOXY)PYRIMIDINE

Custom Q&A

What is the molecular formula of 5-Bromo-2-(pyrrolidin-3-yloxy)pyrimidine?

The molecular formula is C8H10BrN3O.

What is the molecular weight of 5-Bromo-2-(pyrrolidin-3-yloxy)pyrimidine?

The molecular weight is 244.09 g/mol.

What is the IUPAC name of 5-Bromo-2-(pyrrolidin-3-yloxy)pyrimidine?

The IUPAC name is 5-bromo-2-pyrrolidin-3-yloxypyrimidine.

What is the InChI of 5-Bromo-2-(pyrrolidin-3-yloxy)pyrimidine?

The InChI is InChI=1S/C8H10BrN3O/c9-6-3-11-8(12-4-6)13-7-1-2-10-5-7/h3-4,7,10H,1-2,5H2.

What is the InChIKey of 5-Bromo-2-(pyrrolidin-3-yloxy)pyrimidine?

The InChIKey is OJLUWWFOZOXWOI-UHFFFAOYSA-N.

What is the canonical SMILES representation of 5-Bromo-2-(pyrrolidin-3-yloxy)pyrimidine?

The canonical SMILES is C1CNCC1OC2=NC=C(C=N2)Br.

How many hydrogen bond donor counts are there in 5-Bromo-2-(pyrrolidin-3-yloxy)pyrimidine?

There is 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts are there in 5-Bromo-2-(pyrrolidin-3-yloxy)pyrimidine?

There are 4 hydrogen bond acceptor counts.

What is the topological polar surface area of 5-Bromo-2-(pyrrolidin-3-yloxy)pyrimidine?

The topological polar surface area is 47Ų.

Is the compound canonicalized in PubChem?

Yes, the compound is canonicalized in PubChem.