CAS
1188037-01-5 Purity
---
1188037-01-5 Purity
---
Inquiry Basket
5-Bromo-2-hydroxynicotinic acid
CAS
104612-36-4
Catalog Number
ACM104612364
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Bromo-2-hydroxynicotinic acid?
The molecular formula of 5-Bromo-2-hydroxynicotinic acid is C6H4BrNO3.
What is the molecular weight of 5-Bromo-2-hydroxynicotinic acid?
The molecular weight of 5-Bromo-2-hydroxynicotinic acid is 218.00 g/mol.
What is the IUPAC name of 5-Bromo-2-hydroxynicotinic acid?
The IUPAC name of 5-Bromo-2-hydroxynicotinic acid is 5-bromo-2-oxo-1H-pyridine-3-carboxylic acid.
What is the InChI of 5-Bromo-2-hydroxynicotinic acid?
The InChI of 5-Bromo-2-hydroxynicotinic acid is InChI=1S/C6H4BrNO3/c7-3-1-4(6(10)11)5(9)8-2-3/h1-2H,(H,8,9)(H,10,11).
What is the InChIKey of 5-Bromo-2-hydroxynicotinic acid?
The InChIKey of 5-Bromo-2-hydroxynicotinic acid is GYXOTADLHQJPIP-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-2-hydroxynicotinic acid?
The canonical SMILES of 5-Bromo-2-hydroxynicotinic acid is C1=C(C(=O)NC=C1Br)C(=O)O.
What is the CAS number of 5-Bromo-2-hydroxynicotinic acid?
The CAS number of 5-Bromo-2-hydroxynicotinic acid is 104612-36-4.
How many hydrogen bond donor count does 5-Bromo-2-hydroxynicotinic acid have?
5-Bromo-2-hydroxynicotinic acid has 2 hydrogen bond donor count.
How many hydrogen bond acceptor count does 5-Bromo-2-hydroxynicotinic acid have?
5-Bromo-2-hydroxynicotinic acid has 3 hydrogen bond acceptor count.
Recommended Products
