CAS
175422-04-5 Purity
---
175422-04-5 Purity
---
Inquiry Basket
5-Bromo-2-hydroxybenzaldehyde
CAS
1761-61-1
Catalog Number
ACM1761611
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Bromo-2-hydroxybenzaldehyde?
The molecular formula of 5-Bromo-2-hydroxybenzaldehyde is C7H5BrO2.
What is the molecular weight of 5-Bromo-2-hydroxybenzaldehyde?
The molecular weight of 5-Bromo-2-hydroxybenzaldehyde is 201.02 g/mol.
What is the IUPAC name of 5-Bromo-2-hydroxybenzaldehyde?
The IUPAC name of 5-Bromo-2-hydroxybenzaldehyde is 5-bromo-2-hydroxybenzaldehyde.
What is the InChI of 5-Bromo-2-hydroxybenzaldehyde?
The InChI of 5-Bromo-2-hydroxybenzaldehyde is InChI=1S/C7H5BrO2/c8-6-1-2-7(10)5(3-6)4-9/h1-4,10H.
What is the InChIKey of 5-Bromo-2-hydroxybenzaldehyde?
The InChIKey of 5-Bromo-2-hydroxybenzaldehyde is MKKSTJKBKNCMRV-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Bromo-2-hydroxybenzaldehyde?
The canonical SMILES of 5-Bromo-2-hydroxybenzaldehyde is C1=CC(=C(C=C1Br)C=O)O.
What is the CAS number of 5-Bromo-2-hydroxybenzaldehyde?
The CAS number of 5-Bromo-2-hydroxybenzaldehyde is 1761-61-1.
What is the molecular weight of 5-Bromo-2-hydroxybenzaldehyde according to the PubChem computed properties?
The molecular weight of 5-Bromo-2-hydroxybenzaldehyde according to the PubChem computed properties is 201.02 g/mol.
How many hydrogen bond donor count does 5-Bromo-2-hydroxybenzaldehyde have?
5-Bromo-2-hydroxybenzaldehyde has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does 5-Bromo-2-hydroxybenzaldehyde have?
5-Bromo-2-hydroxybenzaldehyde has 2 hydrogen bond acceptor count.
Recommended Products
