CAS
118062-05-8 Purity
98%
118062-05-8 Purity
98%
Inquiry Basket
5-Acetyl-3-thienylboronic acid
CAS
942190-74-1
Catalog Number
ACM942190741
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Acetyl-3-thienylboronic acid?
The molecular formula of 5-Acetyl-3-thienylboronic acid is C6H7BO3S.
What is the molecular weight of 5-Acetyl-3-thienylboronic acid?
The molecular weight of 5-Acetyl-3-thienylboronic acid is 170.00 g/mol.
What is the IUPAC name of 5-Acetyl-3-thienylboronic acid?
The IUPAC name of 5-Acetyl-3-thienylboronic acid is (5-acetylthiophen-3-yl)boronic acid.
What is the InChI of 5-Acetyl-3-thienylboronic acid?
The InChI of 5-Acetyl-3-thienylboronic acid is InChI=1S/C6H7BO3S/c1-4(8)6-2-5(3-11-6)7(9)10/h2-3,9-10H,1H3.
What is the InChIKey of 5-Acetyl-3-thienylboronic acid?
The InChIKey of 5-Acetyl-3-thienylboronic acid is ABXWZNDYRCDJSC-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Acetyl-3-thienylboronic acid?
The canonical SMILES of 5-Acetyl-3-thienylboronic acid is B(C1=CSC(=C1)C(=O)C)(O)O.
How many hydrogen bond donor counts are there in 5-Acetyl-3-thienylboronic acid?
There are 2 hydrogen bond donor counts in 5-Acetyl-3-thienylboronic acid.
How many hydrogen bond acceptor counts are there in 5-Acetyl-3-thienylboronic acid?
There are 4 hydrogen bond acceptor counts in 5-Acetyl-3-thienylboronic acid.
How many rotatable bond counts are there in 5-Acetyl-3-thienylboronic acid?
There are 2 rotatable bond counts in 5-Acetyl-3-thienylboronic acid.
Is 5-Acetyl-3-thienylboronic acid the canonicalized form?
Yes, 5-Acetyl-3-thienylboronic acid is the canonicalized form.
Recommended Products
