5-(4-Fluorophenyl)valeric acid

• CAS: 24484-22-8
• Catalog Number: ACM24484228
• Category: Amines
• Molecular Weight: 196.22
• Molecular Formula: C₁₁H₁₂N₂O₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the Molecular Formula of the compound?

The Molecular Formula of the compound is C11H13FO2.

What is the IUPAC Name of the compound?

The IUPAC Name of the compound is 5-(4-fluorophenyl)pentanoic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C11H13FO2/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h5-8H,1-4H2,(H,13,14).

What is the InChIKey of the compound?

The InChIKey of the compound is BXEFPLJKYWEEAN-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is C1=CC(=CC=C1CCCCC(=O)O)F.

What is the molecular weight of the compound?

The molecular weight of the compound is 196.22 g/mol.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 5 rotatable bond counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.