4H,6H-Thieno[3,4-c]isoxazol-3-amine

• Catalog Number: ACMA00001243
• Category: Amines
• Molecular Weight: 142.18
• Molecular Formula: C₅H₅F₃N₂O
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C5H6N2OS.

What is the molecular weight of the compound?

The molecular weight of the compound is 142.18 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4,6-dihydrothieno[3,4-c][1,2]oxazol-3-amine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C5H6N2OS/c6-5-3-1-9-2-4(3)7-8-5/h1-2,6H2.

What is the InChIKey of the compound?

The InChIKey of the compound is AJGJMXCWYPBNBJ-UHFFFAOYSA-N.

What is the canonical SMILES representation of the compound?

The canonical SMILES representation of the compound is C1C2=C(ON=C2CS1)N.

What is the CAS number of the compound?

The CAS number of the compound is 884325-47-7.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 0.1.

How many hydrogen bond donor and acceptor counts does the compound have?

The compound has 1 hydrogen bond donor count and 4 hydrogen bond acceptor counts.

How many rotatable bonds does the compound have?

The compound has 0 rotatable bonds.