4-Methylcholest-7-en-3-ol

CAS

481-25-4

Catalog Number

ACM481254

Category

Other Products

Molecular Weight

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

4-methylcholest-7-en-3-ol;4α-Methyl-5α-cholest-7-en-3β-ol;Δ7-Methostenol

What is the molecular formula of 4-Methylcholest-7-en-3-ol?

The molecular formula of 4-Methylcholest-7-en-3-ol is C28H48O.

What is the molecular weight of 4-Methylcholest-7-en-3-ol?

The molecular weight of 4-Methylcholest-7-en-3-ol is 400.7 g/mol.

What is the IUPAC Name of 4-Methylcholest-7-en-3-ol?

The IUPAC Name of 4-Methylcholest-7-en-3-ol is (3S,4S,5S,9R,10S,13R,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.

What is the InChI code of 4-Methylcholest-7-en-3-ol?

The InChI code of 4-Methylcholest-7-en-3-ol is InChI=1S/C28H48O/c1-18(2)8-7-9-19(3)22-12-13-24-21-10-11-23-20(4)26(29)15-17-28(23,6)25(21)14-16-27(22,24)5/h10,18-20,22-26,29H,7-9,11-17H2,1-6H3/t19-,20+,22-,23+,24+,25+,26+,27-,28+/m1/s1.

What is the canonical SMILES of 4-Methylcholest-7-en-3-ol?

The canonical SMILES of 4-Methylcholest-7-en-3-ol is CC1C(CCC2(C1CC=C3C2CCC4(C3CCC4C(C)CCCC(C)C)C)C)O.

What is another identifier for 4-Methylcholest-7-en-3-ol?

Another identifier for 4-Methylcholest-7-en-3-ol is CAS number 481-25-4.

How many hydrogen bond donor counts does 4-Methylcholest-7-en-3-ol have?

4-Methylcholest-7-en-3-ol has 1 hydrogen bond donor count.

What is the XLogP3-AA value of 4-Methylcholest-7-en-3-ol?

The XLogP3-AA value of 4-Methylcholest-7-en-3-ol is 8.7.

How many rotatable bond counts does 4-Methylcholest-7-en-3-ol have?

4-Methylcholest-7-en-3-ol has 5 rotatable bond counts.

What is the topological polar surface area of 4-Methylcholest-7-en-3-ol?

The topological polar surface area of 4-Methylcholest-7-en-3-ol is 20.2 Å2.