4-Methyl-3-(trifluoromethyl)benzyl alcohol

• Catalog Number: ACMA00000510
• Category: Alcohols
• Molecular Weight: 190.16
• Molecular Formula: C₉H₈O₄
• Hazard Statements: H302-H319
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C9H9F3O.

Are there any synonyms for the compound?

Yes, the compound has synonyms such as 4-Methyl-3-(trifluoromethyl)benzyl alcohol, 261952-15-2, and [4-methyl-3-(trifluoromethyl)phenyl]methanol.

What is the molecular weight of the compound?

The molecular weight of the compound is 190.16 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is [4-methyl-3-(trifluoromethyl)phenyl]methanol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C9H9F3O/c1-6-2-3-7(5-13)4-8(6)9(10,11)12/h2-4,13H,5H2,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is IUUCVMGJQLDSFO-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC1=C(C=C(C=C1)CO)C(F)(F)F.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 2.3.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 4 hydrogen bond acceptor counts.