CAS
221006-67-3 Purity
---
221006-67-3 Purity
---
Inquiry Basket
4-Methoxymethylphenylboronic acid
CAS
279262-11-2
Catalog Number
ACM279262112
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Methoxymethylphenylboronic acid?
The molecular formula of 4-Methoxymethylphenylboronic acid is C8H11BO3.
What is the molecular weight of 4-Methoxymethylphenylboronic acid?
The molecular weight of 4-Methoxymethylphenylboronic acid is 165.98 g/mol.
What is the IUPAC name of 4-Methoxymethylphenylboronic acid?
The IUPAC name of 4-Methoxymethylphenylboronic acid is [4-(methoxymethyl)phenyl]boronic acid.
What is the InChI of 4-Methoxymethylphenylboronic acid?
The InChI of 4-Methoxymethylphenylboronic acid is InChI=1S/C8H11BO3/c1-12-6-7-2-4-8(5-3-7)9(10)11/h2-5,10-11H,6H2,1H3.
What is the InChIKey of 4-Methoxymethylphenylboronic acid?
The InChIKey of 4-Methoxymethylphenylboronic acid is VTNVZXAYRMTKON-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Methoxymethylphenylboronic acid?
The canonical SMILES of 4-Methoxymethylphenylboronic acid is B(C1=CC=C(C=C1)COC)(O)O.
What is the CAS number of 4-Methoxymethylphenylboronic acid?
The CAS number of 4-Methoxymethylphenylboronic acid is 279262-11-2.
What is the EC number of 4-Methoxymethylphenylboronic acid?
The EC number of 4-Methoxymethylphenylboronic acid is 631-073-2.
Is 4-Methoxymethylphenylboronic acid a canonicalized compound?
Yes, 4-Methoxymethylphenylboronic acid is a canonicalized compound.
Recommended Products
