4-Methoxy-2,6-dimethylphenylboronic acid

• CAS: 361543-99-9
• Catalog Number: ACM361543999
• Category: Boronic Acids
• Molecular Weight: 180.01
• Molecular Formula: C₉H₁₃BO₃
• Synonyms: CHEMBRDG-BB 4006153;2,6-DIMETHYL-4-METHOXYBENZENEBORONIC ACID;(2,6-DIMETHYL-4-METHOXYPHENYL)BORONIC ACID;AKOS BRN-0095;4-Methoxy-2,6-dimethylphenylboronic acid;Boronic acid,B-(4-methoxy-2,6-dimethylphenyl)-;4-Methoxy-2,6-diMethylbenzeneboronic acid, 95%;4

Custom Q&A

What is the molecular formula of 4-Methoxy-2,6-dimethylphenylboronic acid?

The molecular formula is C9H13BO3.

What is the molecular weight of 4-Methoxy-2,6-dimethylphenylboronic acid?

The molecular weight is 180.01 g/mol.

What is the IUPAC name of 4-Methoxy-2,6-dimethylphenylboronic acid?

The IUPAC name is (4-methoxy-2,6-dimethylphenyl)boronic acid.

What is the InChI of 4-Methoxy-2,6-dimethylphenylboronic acid?

The InChI is InChI=1S/C9H13BO3/c1-6-4-8(13-3)5-7(2)9(6)10(11)12/h4-5,11-12H,1-3H3.

What is the InChIKey of 4-Methoxy-2,6-dimethylphenylboronic acid?

The InChIKey is UOSSBXMFWPYHEF-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Methoxy-2,6-dimethylphenylboronic acid?

The canonical SMILES is B(C1=C(C=C(C=C1C)OC)C)(O)O.

What is the CAS number of 4-Methoxy-2,6-dimethylphenylboronic acid?

The CAS number is 361543-99-9.

What is the European Community (EC) number of 4-Methoxy-2,6-dimethylphenylboronic acid?

The EC number is 689-088-5.

What is the DSSTox Substance ID of 4-Methoxy-2,6-dimethylphenylboronic acid?

The DSSTox Substance ID is DTXSID00395428.

Is 4-Methoxy-2,6-dimethylphenylboronic acid considered a canonicalized compound?

Yes, it is considered a canonicalized compound.