4-Hydroxy-2-methylphenylboronic acid

• CAS: 493035-82-8
• Catalog Number: ACM493035828
• Category: Boronic Acids

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is (4-hydroxy-2-methylphenyl)boronic acid.

What is the molecular formula of the compound?

The molecular formula of the compound is C7H9BO3.

What is the molecular weight of the compound?

The molecular weight of the compound is 151.96 g/mol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C7H9BO3/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4,9-11H,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is OYIYNIONWDBJIF-UHFFFAOYSA-N.

What is the canonical SMILES representation of the compound?

The canonical SMILES representation of the compound is B(C1=C(C=C(C=C1)O)C)(O)O.

What is the CAS number of the compound?

The CAS number of the compound is 493035-82-8.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 640-740-7.

What is the DSSTox Substance ID of the compound?

The DSSTox Substance ID of the compound is DTXSID10378464.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 60.7Ų.