4-Dodecyloxybenzoic acid

CAS

2312-15-4

Catalog Number

ACM2312154

Category

Organic & Printed Electronics

Molecular Weight

306.44

Molecular Formula

C₁₉H₃₀O₃

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

Benzoic acid, p-(dodecyloxy)-;para-Dodecyloxybenzoic acid;RARECHEM AL BE 0564;P-(DODECYLOXY)BENZOIC ACID;TIMTEC-BB SBB008006;4-DODECYLOXYBENZOIC ACID;4-N-DODECYLOXYBENZOIC ACID;4-n-Dodecyclobenzoic acid, 98%

What is the molecular formula of 4-Dodecyloxybenzoic acid?

The molecular formula of 4-Dodecyloxybenzoic acid is C19H30O3.

What is the molecular weight of 4-Dodecyloxybenzoic acid?

The molecular weight of 4-Dodecyloxybenzoic acid is 306.4 g/mol.

What is the IUPAC Name of 4-Dodecyloxybenzoic acid?

The IUPAC name of 4-Dodecyloxybenzoic acid is 4-dodecoxybenzoic acid.

What is the InChI of 4-Dodecyloxybenzoic acid?

The InChI of 4-Dodecyloxybenzoic acid is InChI=1S/C19H30O3/c1-2-3-4-5-6-7-8-9-10-11-16-22-18-14-12-17(13-15-18)19(20)21/h12-15H,2-11,16H2,1H3,(H,20,21).

What is the InChIKey of 4-Dodecyloxybenzoic acid?

The InChIKey of 4-Dodecyloxybenzoic acid is ALQLYJHDBAKLBB-UHFFFAOYSA-N.

What is the Canonical SMILES of 4-Dodecyloxybenzoic acid?

The Canonical SMILES of 4-Dodecyloxybenzoic acid is CCCCCCCCCCCCOC1=CC=C(C=C1)C(=O)O.

What is the CAS number of 4-Dodecyloxybenzoic acid?

The CAS number of 4-Dodecyloxybenzoic acid is 2312-15-4.

What is the XLogP3 value of 4-Dodecyloxybenzoic acid?

The XLogP3 value of 4-Dodecyloxybenzoic acid is 7.1.

What is the hydrogen bond donor count of 4-Dodecyloxybenzoic acid?

The hydrogen bond donor count of 4-Dodecyloxybenzoic acid is 1.

What is the hydrogen bond acceptor count of 4-Dodecyloxybenzoic acid?

The hydrogen bond acceptor count of 4-Dodecyloxybenzoic acid is 3.