4-Cyanopyridine-3-boronicacid

• CAS: 874290-90-1
• Catalog Number: ACM874290901
• Category: Boro-Amino Acids
• Molecular Weight: 147.93
• Molecular Formula: C₆H₅BN₂O₂
• Synonyms: BORONIC ACID, (4-CYANO-3-PYRIDINYL)-;4-CYANOPYRIDIN-3-YLBORONIC ACID;4-Cyanopyridine-3-boronic acid, 95%

Custom Q&A

What is the molecular formula of 4-Cyanopyridine-3-boronic acid?

The molecular formula of 4-Cyanopyridine-3-boronic acid is C6H5BN2O2.

What is the molecular weight of 4-Cyanopyridine-3-boronic acid?

The molecular weight of 4-Cyanopyridine-3-boronic acid is 147.93 g/mol.

What is the IUPAC name of 4-Cyanopyridine-3-boronic acid?

The IUPAC name of 4-Cyanopyridine-3-boronic acid is (4-cyanopyridin-3-yl)boronic acid.

What is the InChI of 4-Cyanopyridine-3-boronic acid?

The InChI of 4-Cyanopyridine-3-boronic acid is InChI=1S/C6H5BN2O2/c8-3-5-1-2-9-4-6(5)7(10)11/h1-2,4,10-11H.

What is the InChIKey of 4-Cyanopyridine-3-boronic acid?

The InChIKey of 4-Cyanopyridine-3-boronic acid is BHHPDDMECQZQNL-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Cyanopyridine-3-boronic acid?

The canonical SMILES of 4-Cyanopyridine-3-boronic acid is B(C1=C(C=CN=C1)C#N)(O)O.

What is the CAS number of 4-Cyanopyridine-3-boronic acid?

The CAS number of 4-Cyanopyridine-3-boronic acid is 874290-90-1.

What is the hydrogen bond donor count of 4-Cyanopyridine-3-boronic acid?

The hydrogen bond donor count of 4-Cyanopyridine-3-boronic acid is 2.

What is the hydrogen bond acceptor count of 4-Cyanopyridine-3-boronic acid?

The hydrogen bond acceptor count of 4-Cyanopyridine-3-boronic acid is 4.

Is 4-Cyanopyridine-3-boronic acid a canonicalized compound?

Yes, 4-Cyanopyridine-3-boronic acid is a canonicalized compound.