CAS
108847-76-3 Purity
95%
108847-76-3 Purity
95%
Inquiry Basket
4-Cyano-2,6-dimethylphenylboronic acid
CAS
1451391-43-7
Catalog Number
ACM1451391437
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Cyano-2,6-dimethylphenylboronic acid?
The molecular formula of 4-Cyano-2,6-dimethylphenylboronic acid is C9H10BNO2.
What is the molecular weight of 4-Cyano-2,6-dimethylphenylboronic acid?
The molecular weight of 4-Cyano-2,6-dimethylphenylboronic acid is 174.99 g/mol.
What is the IUPAC Name of 4-Cyano-2,6-dimethylphenylboronic acid?
The IUPAC Name of 4-Cyano-2,6-dimethylphenylboronic acid is (4-cyano-2,6-dimethylphenyl)boronic acid.
What is the InChI of 4-Cyano-2,6-dimethylphenylboronic acid?
The InChI of 4-Cyano-2,6-dimethylphenylboronic acid is InChI=1S/C9H10BNO2/c1-6-3-8(5-11)4-7(2)9(6)10(12)13/h3-4,12-13H,1-2H3.
What is the InChIKey of 4-Cyano-2,6-dimethylphenylboronic acid?
The InChIKey of 4-Cyano-2,6-dimethylphenylboronic acid is JTJKZJPBCISPOI-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Cyano-2,6-dimethylphenylboronic acid?
The canonical SMILES of 4-Cyano-2,6-dimethylphenylboronic acid is B(C1=C(C=C(C=C1C)C#N)C)(O)O.
What is the CAS number of 4-Cyano-2,6-dimethylphenylboronic acid?
The CAS number of 4-Cyano-2,6-dimethylphenylboronic acid is 1451391-43-7.
What is the hydrogen bond donor count of 4-Cyano-2,6-dimethylphenylboronic acid?
The hydrogen bond donor count of 4-Cyano-2,6-dimethylphenylboronic acid is 2.
What is the hydrogen bond acceptor count of 4-Cyano-2,6-dimethylphenylboronic acid?
The hydrogen bond acceptor count of 4-Cyano-2,6-dimethylphenylboronic acid is 3.
What is the topological polar surface area of 4-Cyano-2,6-dimethylphenylboronic acid?
The topological polar surface area of 4-Cyano-2,6-dimethylphenylboronic acid is 64.2Ų.
Recommended Products
