93668-43-0 Purity
97%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H7ClN4.
The molecular weight of the compound is 194.62 g/mol.
The IUPAC name of the compound is 4-chloro-6-(4-methylimidazol-1-yl)pyrimidine.
The InChI of the compound is InChI=1S/C8H7ClN4/c1-6-3-13(5-12-6)8-2-7(9)10-4-11-8/h2-5H,1H3.
The InChIKey of the compound is NTJLKUOVJHBYPT-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CC1=CN(C=N1)C2=CC(=NC=N2)Cl.
The XLogP3-AA value of the compound is 1.6.
The compound has 3 hydrogen bond acceptors.
The topological polar surface area of the compound is 43.6 Å2.
Yes, the compound is canonicalized.