4-Chloro-5-fluoro-2-methoxypyrimidine

• CAS: 1801-06-5
• Catalog Number: ACM1801065
• Category: Other Products
• Molecular Weight: 0
• Molecular Formula: C₅H₄ClFN₂O
• Synonyms: 4-CHLORO-5-FLUORO-2-METHOXYPYRIMIDINE;PyriMidine, 4-chloro-5-fluoro-2-Methoxy-

Custom Q&A

What is the molecular formula of 4-Chloro-5-fluoro-2-methoxypyrimidine?

The molecular formula is C5H4ClFN2O.

What is the PubChem CID of 4-Chloro-5-fluoro-2-methoxypyrimidine?

The PubChem CID is 53439896.

What is the IUPAC name of 4-Chloro-5-fluoro-2-methoxypyrimidine?

The IUPAC name is 4-chloro-5-fluoro-2-methoxypyrimidine.

What is the InChI of 4-Chloro-5-fluoro-2-methoxypyrimidine?

The InChI is InChI=1S/C5H4ClFN2O/c1-10-5-8-2-3(7)4(6)9-5/h2H,1H3.

What is the InChIKey of 4-Chloro-5-fluoro-2-methoxypyrimidine?

The InChIKey is SGXQCZHNMNMMEG-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Chloro-5-fluoro-2-methoxypyrimidine?

The canonical SMILES is COC1=NC=C(C(=N1)Cl)F.

What is the molecular weight of 4-Chloro-5-fluoro-2-methoxypyrimidine?

The molecular weight is 162.55 g/mol.

What is the XLogP3-AA value of 4-Chloro-5-fluoro-2-methoxypyrimidine?

The XLogP3-AA value is 1.6.

How many hydrogen bond acceptors are there in 4-Chloro-5-fluoro-2-methoxypyrimidine?

There are 4 hydrogen bond acceptors.

Is 4-Chloro-5-fluoro-2-methoxypyrimidine a canonicalized compound?

Yes, 4-Chloro-5-fluoro-2-methoxypyrimidine is canonicalized.