4-Chloro-3-fluorobenzeneboronic acid

• CAS: 137504-86-0
• Catalog Number: ACM137504860
• Category: Boronic Acids
• Molecular Weight: 174.36
• Molecular Formula: C₆H₅BClFO₂

Custom Q&A

What is the molecular formula of 4-Chloro-3-fluorobenzeneboronic acid?

The molecular formula of 4-Chloro-3-fluorobenzeneboronic acid is C6H5BClFO2.

What is the molecular weight of 4-Chloro-3-fluorobenzeneboronic acid?

The molecular weight of 4-Chloro-3-fluorobenzeneboronic acid is 174.37 g/mol.

What is the IUPAC name of 4-Chloro-3-fluorobenzeneboronic acid?

The IUPAC name of 4-Chloro-3-fluorobenzeneboronic acid is (4-chloro-3-fluorophenyl)boronic acid.

What is the InChI of 4-Chloro-3-fluorobenzeneboronic acid?

The InChI of 4-Chloro-3-fluorobenzeneboronic acid is InChI=1S/C6H5BClFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H.

What is the InChIKey of 4-Chloro-3-fluorobenzeneboronic acid?

The InChIKey of 4-Chloro-3-fluorobenzeneboronic acid is CMJQIHGBUKZEHP-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Chloro-3-fluorobenzeneboronic acid?

The canonical SMILES of 4-Chloro-3-fluorobenzeneboronic acid is B(C1=CC(=C(C=C1)Cl)F)(O)O.

What is the CAS number of 4-Chloro-3-fluorobenzeneboronic acid?

The CAS number of 4-Chloro-3-fluorobenzeneboronic acid is 137504-86-0.

What is the EC (European Community) number of 4-Chloro-3-fluorobenzeneboronic acid?

The EC number of 4-Chloro-3-fluorobenzeneboronic acid is 675-622-4.

What is the DSSTox Substance ID of 4-Chloro-3-fluorobenzeneboronic acid?

The DSSTox Substance ID of 4-Chloro-3-fluorobenzeneboronic acid is DTXSID70381055.

Is 4-Chloro-3-fluorobenzeneboronic acid a canonicalized compound?

Yes, 4-Chloro-3-fluorobenzeneboronic acid is a canonicalized compound.