--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H9ClN2OS.
The molecular weight of the compound is 216.69 g/mol.
The IUPAC name of the compound is 4-chloro-2-pyrrolidin-1-yl-1,3-thiazole-5-carbaldehyde.
The InChI of the compound is InChI=1S/C8H9ClN2OS/c9-7-6(5-12)13-8(10-7)11-3-1-2-4-11/h5H,1-4H2.
The InChIKey of the compound is RNCWKOPQPWDUBD-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CCN(C1)C2=NC(=C(S2)C=O)Cl.
The CAS number of the compound is 175543-06-3.
The XLogP3-AA value of the compound is 2.7.
The compound has 4 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 61.4 Ǻ².