4-Carboxy-3-methylphenylboronic acid

CAS

191089-06-2

Catalog Number

ACM191089062

Category

Boronic Acids

Molecular Weight

179.96566

Molecular Formula

C8H9 B O4

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

4-CARBOXY-3-METHYLPHENYLBORONIC ACID, 191089-06-2, 4-Borono-2-methylbenzoic acid, SureCN9996737, ACMC-1C060, CTK4E0577, Benzoic acid,4-borono-2-methyl-, MolPort-015-143-315, ANW-23516, AKOS006331903, AG-E-39528, RP03174, AK-61648, KB-37539, Y8108, (3-METHYL-4-CARBOXYPHENYL)BORONIC ACID, A-3556, I04-1877

IUPAC Name

4-borono-2-methylbenzoic acid

Canonical SMILES

B(C1=CC(=C(C=C1)C(=O)O)C)(O)O

InChI Key

JCNNWPPDDRQZJM-UHFFFAOYSA-N

Exact Mass

180.05900

H-Bond Acceptor

H-Bond Donor

What is the molecular formula of 4-Carboxy-3-methylphenylboronic acid?

The molecular formula of 4-Carboxy-3-methylphenylboronic acid is C8H9BO4.

What are the synonyms of 4-Carboxy-3-methylphenylboronic acid?

The synonyms of 4-Carboxy-3-methylphenylboronic acid are: 191089-06-2, 4-Borono-2-methylbenzoic acid, 4-CARBOXY-3-METHYLPHENYLBORONIC ACID, Benzoic acid, 4-borono-2-methyl-.

What is the molecular weight of 4-Carboxy-3-methylphenylboronic acid?

The molecular weight of 4-Carboxy-3-methylphenylboronic acid is 179.97 g/mol.

What is the IUPAC name of 4-Carboxy-3-methylphenylboronic acid?

The IUPAC name of 4-Carboxy-3-methylphenylboronic acid is 4-borono-2-methylbenzoic acid.

What is the InChI of 4-Carboxy-3-methylphenylboronic acid?

The InChI of 4-Carboxy-3-methylphenylboronic acid is InChI=1S/C8H9BO4/c1-5-4-6(9(12)13)2-3-7(5)8(10)11/h2-4,12-13H,1H3,(H,10,11).

What is the InChIKey of 4-Carboxy-3-methylphenylboronic acid?

The InChIKey of 4-Carboxy-3-methylphenylboronic acid is JCNNWPPDDRQZJM-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Carboxy-3-methylphenylboronic acid?

The canonical SMILES of 4-Carboxy-3-methylphenylboronic acid is B(C1=CC(=C(C=C1)C(=O)O)C)(O)O.

What is the CAS number of 4-Carboxy-3-methylphenylboronic acid?

The CAS number of 4-Carboxy-3-methylphenylboronic acid is 191089-06-2.

What is the hydrogen bond donor count of 4-Carboxy-3-methylphenylboronic acid?

The hydrogen bond donor count of 4-Carboxy-3-methylphenylboronic acid is 3.

What is the hydrogen bond acceptor count of 4-Carboxy-3-methylphenylboronic acid?

The hydrogen bond acceptor count of 4-Carboxy-3-methylphenylboronic acid is 4.