4-Bromophenyl dichlorophosphate

• CAS: 19430-76-3
• Catalog Number: ACM19430763
• Category: Organic Phosphine Compounds
• Molecular Weight: 289.88
• Molecular Formula: C₆H₄BrCl₂O₂P
• Synonyms: p-bromophenyl phosphorodichloridate
• Boiling Point: 98-102 °C
• Density: 1.811±0.06 g/cm³
• Appearance: Colorless or light yellow liquid

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 1-bromo-4-dichlorophosphoryloxybenzene.

What is the molecular formula of the compound?

The molecular formula of the compound is C6H4BrCl2O2P.

What is the molecular weight of the compound?

The molecular weight of the compound is 289.88 g/mol.

What is the CAS number of the compound?

The CAS number of the compound is 19430-76-3.

What is the SMILES representation of the compound?

The SMILES representation of the compound is C1=CC(=CC=C1OP(=O)(Cl)Cl)Br.

How many hydrogen bond donor count does the compound have?

The compound has 0 hydrogen bond donor count.

How many hydrogen bond acceptor count does the compound have?

The compound has 2 hydrogen bond acceptor count.

How many rotatable bond count does the compound have?

The compound has 2 rotatable bond count.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 26.3Ų.

Is the compound canonicalized?

Yes, the compound is canonicalized.