4-Bromo-D-phenylalanine hydrochloride

• CAS: 122852-33-9
• Catalog Number: ACM122852339
• Category: Bromine Series
• Molecular Weight: 280.55
• Molecular Formula: C9H10BrNO2.HCl
• Synonyms: (R)-4-Bromophenylalanine hydrochloride;4-Bromo-D-phenylalanine hydrochloride

Custom Q&A

What is the molecular formula of 4-Bromo-D-phenylalanine hydrochloride?

The molecular formula of 4-Bromo-D-phenylalanine hydrochloride is C9H11BrClNO2.

What is the molecular weight of 4-Bromo-D-phenylalanine hydrochloride?

The molecular weight of 4-Bromo-D-phenylalanine hydrochloride is 280.54 g/mol.

What is the IUPAC name of 4-Bromo-D-phenylalanine hydrochloride?

The IUPAC name of 4-Bromo-D-phenylalanine hydrochloride is (2R)-2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride.

What is the InChI of 4-Bromo-D-phenylalanine hydrochloride?

The InChI of 4-Bromo-D-phenylalanine hydrochloride is InChI=1S/C9H10BrNO2.ClH/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;/h1-4,8H,5,11H2,(H,12,13);1H/t8-;/m1./s1.

What is the InChIKey of 4-Bromo-D-phenylalanine hydrochloride?

The InChIKey of 4-Bromo-D-phenylalanine hydrochloride is GRWMPXZZFAPLFZ-DDWIOCJRSA-N.

What is the canonical SMILES of 4-Bromo-D-phenylalanine hydrochloride?

The canonical SMILES of 4-Bromo-D-phenylalanine hydrochloride is C1=CC(=CC=C1CC(C(=O)O)N)Br.Cl.

What is the isomeric SMILES of 4-Bromo-D-phenylalanine hydrochloride?

The isomeric SMILES of 4-Bromo-D-phenylalanine hydrochloride is C1=CC(=CC=C1C[C@H](C(=O)O)N)Br.Cl.

What is the CAS number of 4-Bromo-D-phenylalanine hydrochloride?

The CAS number of 4-Bromo-D-phenylalanine hydrochloride is 122852-33-9.

What is the hydrogen bond donor count of 4-Bromo-D-phenylalanine hydrochloride?

The hydrogen bond donor count of 4-Bromo-D-phenylalanine hydrochloride is 3.

What is the hydrogen bond acceptor count of 4-Bromo-D-phenylalanine hydrochloride?

The hydrogen bond acceptor count of 4-Bromo-D-phenylalanine hydrochloride is 3.