4-Bromo-7-methoxyquinoline

• CAS: 1070879-27-4
• Catalog Number: ACM1070879274
• Category: Bromine Series
• Molecular Weight: 238.08
• Molecular Formula: C₁₀H₈BrNO
• Synonyms: 4-BROMO-7-METHOXYQUINOLINE

Custom Q&A

What is the molecular formula of 4-Bromo-7-methoxyquinoline?

The molecular formula of 4-Bromo-7-methoxyquinoline is C10H8BrNO.

What is the molecular weight of 4-Bromo-7-methoxyquinoline?

The molecular weight of 4-Bromo-7-methoxyquinoline is 238.08 g/mol.

What is the IUPAC name of 4-Bromo-7-methoxyquinoline?

The IUPAC name of 4-Bromo-7-methoxyquinoline is 4-bromo-7-methoxyquinoline.

What is the InChI of 4-Bromo-7-methoxyquinoline?

The InChI of 4-Bromo-7-methoxyquinoline is InChI=1S/C10H8BrNO/c1-13-7-2-3-8-9(11)4-5-12-10(8)6-7/h2-6H,1H3.

What is the InChIKey of 4-Bromo-7-methoxyquinoline?

The InChIKey of 4-Bromo-7-methoxyquinoline is HSLGTRSMCWHZQH-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromo-7-methoxyquinoline?

The canonical SMILES of 4-Bromo-7-methoxyquinoline is COC1=CC2=NC=CC(=C2C=C1)Br.

What is the CAS number of 4-Bromo-7-methoxyquinoline?

The CAS number of 4-Bromo-7-methoxyquinoline is 1070879-27-4.

What is the XLogP3 value of 4-Bromo-7-methoxyquinoline?

The XLogP3 value of 4-Bromo-7-methoxyquinoline is 3.

How many hydrogen bond donor count does 4-Bromo-7-methoxyquinoline have?

4-Bromo-7-methoxyquinoline has 0 hydrogen bond donor count.

How many hydrogen bond acceptor count does 4-Bromo-7-methoxyquinoline have?

4-Bromo-7-methoxyquinoline has 2 hydrogen bond acceptor count.