CAS
297760-76-0 Purity
---
297760-76-0 Purity
---
Inquiry Basket
4-Bromo-6-methoxyisoindolin-1-one
CAS
808127-75-5
Catalog Number
ACM808127755
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Bromo-6-methoxyisoindolin-1-one?
The molecular formula of 4-Bromo-6-methoxyisoindolin-1-one is C9H8BrNO2.
What is the molecular weight of 4-Bromo-6-methoxyisoindolin-1-one?
The molecular weight of 4-Bromo-6-methoxyisoindolin-1-one is 242.07 g/mol.
What is the IUPAC name of 4-Bromo-6-methoxyisoindolin-1-one?
The IUPAC name of 4-Bromo-6-methoxyisoindolin-1-one is 4-bromo-6-methoxy-2,3-dihydroisoindol-1-one.
What is the InChI of 4-Bromo-6-methoxyisoindolin-1-one?
The InChI of 4-Bromo-6-methoxyisoindolin-1-one is InChI=1S/C9H8BrNO2/c1-13-5-2-6-7(8(10)3-5)4-11-9(6)12/h2-3H,4H2,1H3,(H,11,12).
What is the InChIKey of 4-Bromo-6-methoxyisoindolin-1-one?
The InChIKey of 4-Bromo-6-methoxyisoindolin-1-one is VIQFTBKHVUBFJG-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-6-methoxyisoindolin-1-one?
The canonical SMILES of 4-Bromo-6-methoxyisoindolin-1-one is COC1=CC2=C(CNC2=O)C(=C1)Br.
What is the CAS identification number of 4-Bromo-6-methoxyisoindolin-1-one?
The CAS identification number of 4-Bromo-6-methoxyisoindolin-1-one is 808127-75-5.
How many hydrogen bond donor counts does 4-Bromo-6-methoxyisoindolin-1-one have?
4-Bromo-6-methoxyisoindolin-1-one has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 4-Bromo-6-methoxyisoindolin-1-one have?
4-Bromo-6-methoxyisoindolin-1-one has 2 hydrogen bond acceptor counts.
Recommended Products
