4-Bromo-5-fluoro-2-nitrotoluene

• CAS: 224185-19-7
• Catalog Number: ACM224185197
• Category: Bromine Series
• Molecular Weight: 234.02
• Molecular Formula: C₇H₅BrFNO₂

Custom Q&A

What is the molecular formula of 4-Bromo-5-fluoro-2-nitrotoluene?

The molecular formula is C7H5BrFNO2.

What is the molecular weight of 4-Bromo-5-fluoro-2-nitrotoluene?

The molecular weight is 234.02 g/mol.

What is the IUPAC name of 4-Bromo-5-fluoro-2-nitrotoluene?

The IUPAC name is 1-bromo-2-fluoro-4-methyl-5-nitrobenzene.

What is the InChI of 4-Bromo-5-fluoro-2-nitrotoluene?

The InChI is InChI=1S/C7H5BrFNO2/c1-4-2-6(9)5(8)3-7(4)10(11)12/h2-3H,1H3.

What is the InChIKey of 4-Bromo-5-fluoro-2-nitrotoluene?

The InChIKey is MTTNTJRJOFVWSY-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromo-5-fluoro-2-nitrotoluene?

The canonical SMILES is CC1=CC(=C(C=C1[N+](=O)[O-])Br)F.

What is the CAS number of 4-Bromo-5-fluoro-2-nitrotoluene?

The CAS number is 224185-19-7.

What is the European Community (EC) Number of 4-Bromo-5-fluoro-2-nitrotoluene?

The European Community (EC) Number is 625-785-2.

What is the DSSTox Substance ID of 4-Bromo-5-fluoro-2-nitrotoluene?

The DSSTox Substance ID is DTXSID70381414.

Is 4-Bromo-5-fluoro-2-nitrotoluene a canonical compound?

Yes, it is a canonical compound.