4-Bromo-5-fluoro-1H-indole

• CAS: 1227493-96-0
• Catalog Number: ACM1227493960
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 4-Bromo-5-fluoro-1H-indole?

The molecular formula of 4-Bromo-5-fluoro-1H-indole is C8H5BrFN.

What is the molecular weight of 4-Bromo-5-fluoro-1H-indole?

The molecular weight of 4-Bromo-5-fluoro-1H-indole is 214.03 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-bromo-5-fluoro-1H-indole.

What is the InChI of 4-Bromo-5-fluoro-1H-indole?

The InChI of 4-Bromo-5-fluoro-1H-indole is InChI=1S/C8H5BrFN/c9-8-5-3-4-11-7(5)2-1-6(8)10/h1-4,11H.

What is the InChIKey of 4-Bromo-5-fluoro-1H-indole?

The InChIKey of 4-Bromo-5-fluoro-1H-indole is CIRXFJXMJOVFMR-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromo-5-fluoro-1H-indole?

The canonical SMILES of 4-Bromo-5-fluoro-1H-indole is C1=CC(=C(C2=C1NC=C2)Br)F.

What is the XLogP3-AA value of 4-Bromo-5-fluoro-1H-indole?

The XLogP3-AA value of 4-Bromo-5-fluoro-1H-indole is 2.8.

How many hydrogen bond donor counts does 4-Bromo-5-fluoro-1H-indole have?

4-Bromo-5-fluoro-1H-indole has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 4-Bromo-5-fluoro-1H-indole have?

4-Bromo-5-fluoro-1H-indole has 1 hydrogen bond acceptor count.

How many rotatable bond counts does 4-Bromo-5-fluoro-1H-indole have?

4-Bromo-5-fluoro-1H-indole has 0 rotatable bond count.