4-Bromo-3-methyl-5-phenylisoxazole

• CAS: 31301-50-5
• Catalog Number: ACM31301505
• Category: Other Products
• Molecular Weight: 238.08062
• Molecular Formula: C₁₀H₈BrNO
• Synonyms: 4-BroMo-3-Methyl-5-phenylisoxazole

Custom Q&A

What is the molecular formula of 4-Bromo-3-methyl-5-phenylisoxazole?

The molecular formula of 4-Bromo-3-methyl-5-phenylisoxazole is C10H8BrNO.

What is the molecular weight of 4-Bromo-3-methyl-5-phenylisoxazole?

The molecular weight of 4-Bromo-3-methyl-5-phenylisoxazole is 238.08 g/mol.

What is the IUPAC name of 4-Bromo-3-methyl-5-phenylisoxazole?

The IUPAC name of 4-Bromo-3-methyl-5-phenylisoxazole is 4-bromo-3-methyl-5-phenyl-1,2-oxazole.

What is the InChIKey of 4-Bromo-3-methyl-5-phenylisoxazole?

The InChIKey of 4-Bromo-3-methyl-5-phenylisoxazole is CRZPMYDRPGDHQX-UHFFFAOYSA-N.

What is the Canonical SMILES of 4-Bromo-3-methyl-5-phenylisoxazole?

The Canonical SMILES of 4-Bromo-3-methyl-5-phenylisoxazole is CC1=NOC(=C1Br)C2=CC=CC=C2.

How many hydrogen bond donor counts does 4-Bromo-3-methyl-5-phenylisoxazole have?

4-Bromo-3-methyl-5-phenylisoxazole has 0 hydrogen bond donor counts.

What is the XLogP3-AA value of 4-Bromo-3-methyl-5-phenylisoxazole?

The XLogP3-AA value of 4-Bromo-3-methyl-5-phenylisoxazole is 3.1.

What is the topological polar surface area of 4-Bromo-3-methyl-5-phenylisoxazole?

The topological polar surface area of 4-Bromo-3-methyl-5-phenylisoxazole is 26 2.

How many heavy atom counts does 4-Bromo-3-methyl-5-phenylisoxazole have?

4-Bromo-3-methyl-5-phenylisoxazole has 13 heavy atom counts.

Is 4-Bromo-3-methyl-5-phenylisoxazole a canonicalized compound?

Yes, 4-Bromo-3-methyl-5-phenylisoxazole is a canonicalized compound according to PubChem.