4-Bromo-3-chloro-2-fluoroaniline

• CAS: 115843-99-7
• Catalog Number: ACM115843997
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 4-Bromo-3-chloro-2-fluoroaniline?

The molecular formula of 4-Bromo-3-chloro-2-fluoroaniline is C6H4BrClFN.

What is the molecular weight of 4-Bromo-3-chloro-2-fluoroaniline?

The molecular weight of 4-Bromo-3-chloro-2-fluoroaniline is 224.46 g/mol.

What is the IUPAC name of 4-Bromo-3-chloro-2-fluoroaniline?

The IUPAC name of 4-Bromo-3-chloro-2-fluoroaniline is 4-bromo-3-chloro-2-fluoroaniline.

What is the InChI of 4-Bromo-3-chloro-2-fluoroaniline?

The InChI of 4-Bromo-3-chloro-2-fluoroaniline is InChI=1S/C6H4BrClFN/c7-3-1-2-4(10)6(9)5(3)8/h1-2H,10H2.

What is the InChIKey of 4-Bromo-3-chloro-2-fluoroaniline?

The InChIKey of 4-Bromo-3-chloro-2-fluoroaniline is WYXZIQDHENNEPU-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromo-3-chloro-2-fluoroaniline?

The canonical SMILES of 4-Bromo-3-chloro-2-fluoroaniline is C1=CC(=C(C(=C1N)F)Cl)Br.

What is the CAS number of 4-Bromo-3-chloro-2-fluoroaniline?

The CAS number of 4-Bromo-3-chloro-2-fluoroaniline is 115843-99-7.

What is the molecular weight of 4-Bromo-3-chloro-2-fluoroaniline according to PubChem?

The molecular weight of 4-Bromo-3-chloro-2-fluoroaniline according to PubChem is 224.46 g/mol.

How many hydrogen bond donor count does 4-Bromo-3-chloro-2-fluoroaniline have?

4-Bromo-3-chloro-2-fluoroaniline has 1 hydrogen bond donor count.

How many hydrogen bond acceptor count does 4-Bromo-3-chloro-2-fluoroaniline have?

4-Bromo-3-chloro-2-fluoroaniline has 2 hydrogen bond acceptor count.