149947-15-9 Purity
97%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H13BrO.
The molecular weight of the compound is 229.11 g/mol.
The IUPAC name of the compound is 4-bromo-5-methyl-2-propan-2-ylphenol.
The CAS number of the compound is 15062-34-7.
The InChI key of the compound is ZSIQWWYOUYOECH-UHFFFAOYSA-N.
The canonical SMILES representation of the compound is CC1=CC(=C(C=C1Br)C(C)C)O.
The XLogP3 value of the compound is 4.
The compound has 1 hydrogen bond donor count.
The compound has 1 hydrogen bond acceptor count.
The compound has 1 rotatable bond count.