4-Bromo-2-chloro-3-fluoropyridine

• CAS: 1211526-56-5
• Catalog Number: ACM1211526565
• Category: Pyridines
• Molecular Weight: 210.4
• Molecular Formula: C5H2BrClFN

Custom Q&A

What is the molecular formula of 4-Bromo-2-chloro-3-fluoropyridine?

The molecular formula of 4-Bromo-2-chloro-3-fluoropyridine is C5H2BrClFN.

What is the molecular weight of 4-Bromo-2-chloro-3-fluoropyridine?

The molecular weight of 4-Bromo-2-chloro-3-fluoropyridine is 210.43 g/mol.

How was the molecular weight computed?

The molecular weight was computed by PubChem 2.2.

What is the IUPAC name of 4-Bromo-2-chloro-3-fluoropyridine?

The IUPAC name of 4-Bromo-2-chloro-3-fluoropyridine is 4-bromo-2-chloro-3-fluoropyridine.

What is the InChI of 4-Bromo-2-chloro-3-fluoropyridine?

The InChI of 4-Bromo-2-chloro-3-fluoropyridine is InChI=1S/C5H2BrClFN/c6-3-1-2-9-5(7)4(3)8/h1-2H.

What is the InChIKey of 4-Bromo-2-chloro-3-fluoropyridine?

The InChIKey of 4-Bromo-2-chloro-3-fluoropyridine is NENRVRYZBQACQZ-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromo-2-chloro-3-fluoropyridine?

The canonical SMILES of 4-Bromo-2-chloro-3-fluoropyridine is C1=CN=C(C(=C1Br)F)Cl.

What is the CAS number of 4-Bromo-2-chloro-3-fluoropyridine?

The CAS number of 4-Bromo-2-chloro-3-fluoropyridine is 1211526-56-5.

What is the DSSTox Substance ID of 4-Bromo-2-chloro-3-fluoropyridine?

The DSSTox Substance ID of 4-Bromo-2-chloro-3-fluoropyridine is DTXSID20717820.

Is 4-Bromo-2-chloro-3-fluoropyridine a canonicalized compound?

Yes, 4-Bromo-2-chloro-3-fluoropyridine is a canonicalized compound, according to PubChem.