4-Biphenylcarboxylic acid

• CAS: 92-92-2
• Catalog Number: ACM92922
• Category: Boronic Acids
• Molecular Weight: 198.22
• Molecular Formula: C₁₃H₁₀O₂

Custom Q&A

What is the molecular formula of 4-Biphenylcarboxylic acid?

The molecular formula of 4-Biphenylcarboxylic acid is C13H10O2.

What is the molecular weight of 4-Biphenylcarboxylic acid?

The molecular weight of 4-Biphenylcarboxylic acid is 198.22 g/mol.

What is the IUPAC name of 4-Biphenylcarboxylic acid?

The IUPAC name of 4-Biphenylcarboxylic acid is 4-phenylbenzoic acid.

What is the InChI of 4-Biphenylcarboxylic acid?

The InChI of 4-Biphenylcarboxylic acid is InChI=1S/C13H10O2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H,14,15).

What is the InChIKey of 4-Biphenylcarboxylic acid?

The InChIKey of 4-Biphenylcarboxylic acid is NNJMFJSKMRYHSR-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Biphenylcarboxylic acid?

The canonical SMILES of 4-Biphenylcarboxylic acid is C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O.

What is the CAS number of 4-Biphenylcarboxylic acid?

The CAS number of 4-Biphenylcarboxylic acid is 92-92-2.

What is the XLogP3 value of 4-Biphenylcarboxylic acid?

The XLogP3 value of 4-Biphenylcarboxylic acid is 3.5.

How many hydrogen bond donor count does 4-Biphenylcarboxylic acid have?

4-Biphenylcarboxylic acid has 1 hydrogen bond donor count.

How many hydrogen bond acceptor count does 4-Biphenylcarboxylic acid have?

4-Biphenylcarboxylic acid has 2 hydrogen bond acceptor count.