4-(Benzyloxy)-2-fluorobenzoic acid

• Catalog Number: ACMA00001745
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 246.23
• Molecular Formula: C₁₄H₁₀ClFO₃
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 4-(Benzyloxy)-2-fluorobenzoic acid?

The molecular formula is C14H11FO3.

When was the compound first created?

The compound was first created on December 5, 2007.

What is the IUPAC name of 4-(Benzyloxy)-2-fluorobenzoic acid?

The IUPAC name is 2-fluoro-4-phenylmethoxybenzoic acid.

What is the InChIKey of the compound?

The InChIKey is HWQRXVRKZFDKLJ-UHFFFAOYSA-N.

What is the molecular weight of the compound?

The molecular weight is 246.23 g/mol.

What is the Canonical SMILES of the compound?

The Canonical SMILES is C1=CC=C(C=C1)COC2=CC(=C(C=C2)C(=O)O)F.

How many hydrogen bond donor counts are there in the compound?

There is 1 hydrogen bond donor count.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 3.

What is the topological polar surface area of the compound?

The topological polar surface area is 46.5 Å2.

Is the compound considered canonicalized?

Yes, the compound is considered canonicalized.