4-Aminobenzylphosphonic acid

• CAS: 5424-27-1
• Catalog Number: ACM5424271
• Category: Biomaterials
• Molecular Weight: 187.13
• Molecular Formula: C₇H₁₀NO₃P
• Synonyms: 4-AMINOBENZYLPHOSPHONIC ACID;(4-Aminophenyl)methylphosphonic acid;(4-azanylphenyl)methylphosphonic acid;4-Aminobenzylphosphonic acid >=95%

Custom Q&A

What is the molecular formula of 4-Aminobenzylphosphonic acid?

The molecular formula of 4-Aminobenzylphosphonic acid is C7H10NO3P.

What is the molecular weight of 4-Aminobenzylphosphonic acid?

The molecular weight of 4-Aminobenzylphosphonic acid is 187.13 g/mol.

What is the IUPAC name of 4-Aminobenzylphosphonic acid?

The IUPAC name of 4-Aminobenzylphosphonic acid is (4-aminophenyl)methylphosphonic acid.

What is the InChI of 4-Aminobenzylphosphonic acid?

The InChI of 4-Aminobenzylphosphonic acid is InChI=1S/C7H10NO3P/c8-7-3-1-6(2-4-7)5-12(9,10)11/h1-4H,5,8H2,(H2,9,10,11).

What is the InChIKey of 4-Aminobenzylphosphonic acid?

The InChIKey of 4-Aminobenzylphosphonic acid is NEKHKXMBGWNTOO-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Aminobenzylphosphonic acid?

The canonical SMILES of 4-Aminobenzylphosphonic acid is C1=CC(=CC=C1CP(=O)(O)O)N.

What is the CAS number of 4-Aminobenzylphosphonic acid?

The CAS number of 4-Aminobenzylphosphonic acid is 5424-27-1.

How many hydrogen bond donors are there in 4-Aminobenzylphosphonic acid?

There are 3 hydrogen bond donors in 4-Aminobenzylphosphonic acid.

How many hydrogen bond acceptors are there in 4-Aminobenzylphosphonic acid?

There are 4 hydrogen bond acceptors in 4-Aminobenzylphosphonic acid.