CAS
--- Purity
---
--- Purity
---
Inquiry Basket
4-Amino-2,5-dichloro-benzenesulfonyl chloride
Catalog Number
ACMA00001595
Category
Aryl
Molecular Weight
260.53
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of the compound?
The molecular formula of the compound is C6H4Cl3NO2S.
What is the molecular weight of the compound?
The molecular weight of the compound is 260.5 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-amino-2,5-dichlorobenzenesulfonyl chloride.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C6H4Cl3NO2S/c7-3-2-6(13(9,11)12)4(8)1-5(3)10/h1-2H,10H2.
What is the InChIKey of the compound?
The InChIKey of the compound is BAWYRVMRUXDHTQ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=C(C(=CC(=C1Cl)S(=O)(=O)Cl)Cl)N.
What is the CAS number of the compound?
The CAS number of the compound is 4857-94-7.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 610-426-4.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.5.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 68.5Ų.
Recommended Products
